About [6-(4-fluorophenyl)-2,2,4-trimethyl-1H-quinolin-5-yl]methanol
[6-(4-fluorophenyl)-2,2,4-trimethyl-1H-quinolin-5-yl]methanol (PubChem CID 58026939) has the molecular formula C19H20FNO
and a molecular weight of 297.37 g/mol. Its IUPAC name is [6-(4-fluorophenyl)-2,2,4-trimethyl-1H-quinolin-5-yl]methanol.
Molecular Properties
| Compound Name | [6-(4-fluorophenyl)-2,2,4-trimethyl-1H-quinolin-5-yl]methanol |
| PubChem CID | 58026939 |
| Molecular Formula | C19H20FNO |
| Molecular Weight | 297.37 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | [6-(4-fluorophenyl)-2,2,4-trimethyl-1H-quinolin-5-yl]methanol |
| SMILES | CC1=CC(C)(C)Nc2ccc(-c3ccc(F)cc3)c(CO)c21 |
| InChI | InChI=1S/C19H20FNO/c1-12-10-19(2,3)21-17-9-8-15(16(11-22)18(12)17)13-4-6-14(20)7-5-13/h4-10,21-22H,11H2,1-3H3 |
| InChIKey | FWDNUEKUQNKZHR-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.37 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [6-(4-fluorophenyl)-2,2,4-trimethyl-1H-quinolin-5-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(4-fluorophenyl)-2,2,4-trimethyl-1H-quinolin-5-yl]methanol?
The IUPAC name of [6-(4-fluorophenyl)-2,2,4-trimethyl-1H-quinolin-5-yl]methanol (CID 58026939) is [6-(4-fluorophenyl)-2,2,4-trimethyl-1H-quinolin-5-yl]methanol.
What is the SMILES notation for [6-(4-fluorophenyl)-2,2,4-trimethyl-1H-quinolin-5-yl]methanol?
The canonical SMILES for [6-(4-fluorophenyl)-2,2,4-trimethyl-1H-quinolin-5-yl]methanol is CC1=CC(C)(C)Nc2ccc(-c3ccc(F)cc3)c(CO)c21.
What is the InChIKey of [6-(4-fluorophenyl)-2,2,4-trimethyl-1H-quinolin-5-yl]methanol?
The InChIKey is FWDNUEKUQNKZHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20FNO/c1-12-10-19(2,3)21-17-9-8-15(16(11-22)18(12)17)13-4-6-14(20)7-5-13/h4-10,21-22H,11H2,1-3H3.
What are the key properties of [6-(4-fluorophenyl)-2,2,4-trimethyl-1H-quinolin-5-yl]methanol?
[6-(4-fluorophenyl)-2,2,4-trimethyl-1H-quinolin-5-yl]methanol has a molecular weight of 297.37 g/mol, XLogP of 4.59, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(4-fluorophenyl)-2,2,4-trimethyl-1H-quinolin-5-yl]methanol is sourced from PubChem (CID 58026939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).