C46H32F34O4S2 — CID 58027764
bis[4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanylmethyl)-2,6-dimethylphenyl] benzene-1,4-dicarboxylate (PubChem CID 58027764) has the molecular formula C46H32F34O4S2 and a molecular weight of 1358.82 g/mol. Its IUPAC name is bis[4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanylmethyl)-2,6-dimethylphenyl] benzene-1,4-dicarboxylate.
| Compound Name | bis[4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanylmethyl)-2,6-dimethylphenyl] benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 58027764 |
| Molecular Formula | C46H32F34O4S2 |
| Molecular Weight | 1358.82 g/mol |
| Exact Mass | 1358.12 |
| IUPAC Name | bis[4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanylmethyl)-2,6-dimethylphenyl] benzene-1,4-dicarboxylate |
| SMILES | Cc1cc(CSCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc(C)c1OC(=O)c1ccc(C(=O)Oc2c(C)cc(CSCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc2C)cc1 |
| InChI | InChI=1S/C46H32F34O4S2/c1-19-13-23(17-85-11-9-31(47,48)33(51,52)35(55,56)37(59,60)39(63,64)41(67,68)43(71,72)45(75,76)77)14-20(2)27(19)83-29(81)25-5-7-26(8-6-25)30(82)84-28-21(3)15-24(16-22(28)4)18-86-12-10-32(49,50)34(53,54)36(57,58)38(61,62)40(65,66)42(69,70)44(73,74)46(78,79)80/h5-8,13-16H,9-12,17-18H2,1-4H3 |
| InChIKey | KRAOJTZZEZTSDP-UHFFFAOYSA-N |
| XLogP | 18.62 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 86 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1358.82 |
| LogP ≤ 5 | 18.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|