C19H35N3O2S2 — CID 58027948
(1S,5R,9R,13S)-5-(2-aminoacetyl)-5,9-dimethyl-9-(methylamino)-3,11-dithia-6-azabicyclo[11.4.0]heptadecan-8-one (PubChem CID 58027948) has the molecular formula C19H35N3O2S2 and a molecular weight of 401.64 g/mol. Its IUPAC name is (1S,5R,9R,13S)-5-(2-aminoacetyl)-5,9-dimethyl-9-(methylamino)-3,11-dithia-6-azabicyclo[11.4.0]heptadecan-8-one.
| Compound Name | (1S,5R,9R,13S)-5-(2-aminoacetyl)-5,9-dimethyl-9-(methylamino)-3,11-dithia-6-azabicyclo[11.4.0]heptadecan-8-one |
|---|---|
| PubChem CID | 58027948 |
| Molecular Formula | C19H35N3O2S2 |
| Molecular Weight | 401.64 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | (1S,5R,9R,13S)-5-(2-aminoacetyl)-5,9-dimethyl-9-(methylamino)-3,11-dithia-6-azabicyclo[11.4.0]heptadecan-8-one |
| SMILES | CN[C@@]1(C)CSC[C@H]2CCCC[C@@H]2CSC[C@@](C)(C(=O)CN)NCC1=O |
| InChI | InChI=1S/C19H35N3O2S2/c1-18(21-3)12-25-10-14-6-4-5-7-15(14)11-26-13-19(2,16(23)8-20)22-9-17(18)24/h14-15,21-22H,4-13,20H2,1-3H3/t14-,15-,18+,19+/m1/s1 |
| InChIKey | IVYTVRCHAUGDCO-LTDCPUDJSA-N |
| XLogP | 1.70 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.64 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |