C18H16N2O — CID 58028137
3-methyl-7-phenyl-6,7,8,9-tetrahydropyrido[2,3-b]indol-5-one (PubChem CID 58028137) has the molecular formula C18H16N2O and a molecular weight of 276.34 g/mol. Its IUPAC name is 3-methyl-7-phenyl-6,7,8,9-tetrahydropyrido[2,3-b]indol-5-one.
| Compound Name | 3-methyl-7-phenyl-6,7,8,9-tetrahydropyrido[2,3-b]indol-5-one |
|---|---|
| PubChem CID | 58028137 |
| Molecular Formula | C18H16N2O |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 3-methyl-7-phenyl-6,7,8,9-tetrahydropyrido[2,3-b]indol-5-one |
| SMILES | Cc1cnc2[nH]c3c(c2c1)C(=O)CC(c1ccccc1)C3 |
| InChI | InChI=1S/C18H16N2O/c1-11-7-14-17-15(20-18(14)19-10-11)8-13(9-16(17)21)12-5-3-2-4-6-12/h2-7,10,13H,8-9H2,1H3,(H,19,20) |
| InChIKey | QRNVPMWNQCGREM-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |