C40H40N2OS — CID 58028223
2-[9,10-ditert-butyl-6-(5,6-dimethyl-1,3-benzothiazol-2-yl)anthracen-2-yl]-5,6-dimethyl-1,3-benzoxazole (PubChem CID 58028223) has the molecular formula C40H40N2OS and a molecular weight of 596.84 g/mol. Its IUPAC name is 2-[9,10-ditert-butyl-6-(5,6-dimethyl-1,3-benzothiazol-2-yl)anthracen-2-yl]-5,6-dimethyl-1,3-benzoxazole.
| Compound Name | 2-[9,10-ditert-butyl-6-(5,6-dimethyl-1,3-benzothiazol-2-yl)anthracen-2-yl]-5,6-dimethyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 58028223 |
| Molecular Formula | C40H40N2OS |
| Molecular Weight | 596.84 g/mol |
| Exact Mass | 596.29 |
| IUPAC Name | 2-[9,10-ditert-butyl-6-(5,6-dimethyl-1,3-benzothiazol-2-yl)anthracen-2-yl]-5,6-dimethyl-1,3-benzoxazole |
| SMILES | Cc1cc2nc(-c3ccc4c(C(C)(C)C)c5cc(-c6nc7cc(C)c(C)cc7s6)ccc5c(C(C)(C)C)c4c3)oc2cc1C |
| InChI | InChI=1S/C40H40N2OS/c1-21-15-31-33(17-23(21)3)43-37(41-31)25-11-13-27-29(19-25)35(39(5,6)7)28-14-12-26(20-30(28)36(27)40(8,9)10)38-42-32-16-22(2)24(4)18-34(32)44-38/h11-20H,1-10H3 |
| InChIKey | LPFBPPRJXUACTC-UHFFFAOYSA-N |
| XLogP | 11.91 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.84 |
| LogP ≤ 5 | 11.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|