C46H30N2O3S — CID 58028238
2-[5-(5,6-diphenyl-1,3-benzothiazol-2-yl)-3,6-dimethylfuro[3,2-b]furan-2-yl]-5,6-diphenyl-1,3-benzoxazole (PubChem CID 58028238) has the molecular formula C46H30N2O3S and a molecular weight of 690.82 g/mol. Its IUPAC name is 2-[5-(5,6-diphenyl-1,3-benzothiazol-2-yl)-3,6-dimethylfuro[3,2-b]furan-2-yl]-5,6-diphenyl-1,3-benzoxazole.
| Compound Name | 2-[5-(5,6-diphenyl-1,3-benzothiazol-2-yl)-3,6-dimethylfuro[3,2-b]furan-2-yl]-5,6-diphenyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 58028238 |
| Molecular Formula | C46H30N2O3S |
| Molecular Weight | 690.82 g/mol |
| Exact Mass | 690.20 |
| IUPAC Name | 2-[5-(5,6-diphenyl-1,3-benzothiazol-2-yl)-3,6-dimethylfuro[3,2-b]furan-2-yl]-5,6-diphenyl-1,3-benzoxazole |
| SMILES | Cc1c(-c2nc3cc(-c4ccccc4)c(-c4ccccc4)cc3o2)oc2c(C)c(-c3nc4cc(-c5ccccc5)c(-c5ccccc5)cc4s3)oc12 |
| InChI | InChI=1S/C46H30N2O3S/c1-27-41-42(50-43(27)45-47-37-23-33(29-15-7-3-8-16-29)35(25-39(37)49-45)31-19-11-5-12-20-31)28(2)44(51-41)46-48-38-24-34(30-17-9-4-10-18-30)36(26-40(38)52-46)32-21-13-6-14-22-32/h3-26H,1-2H3 |
| InChIKey | ZMKAOPQLCGQWGE-UHFFFAOYSA-N |
| XLogP | 13.40 |
| TPSA | 65.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.82 |
| LogP ≤ 5 | 13.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |