C32H18F6N2S2 — CID 58028261
2-[9,10-dimethyl-6-[6-(trifluoromethyl)-1,3-benzothiazol-2-yl]anthracen-2-yl]-6-(trifluoromethyl)-1,3-benzothiazole (PubChem CID 58028261) has the molecular formula C32H18F6N2S2 and a molecular weight of 608.63 g/mol. Its IUPAC name is 2-[9,10-dimethyl-6-[6-(trifluoromethyl)-1,3-benzothiazol-2-yl]anthracen-2-yl]-6-(trifluoromethyl)-1,3-benzothiazole.
| Compound Name | 2-[9,10-dimethyl-6-[6-(trifluoromethyl)-1,3-benzothiazol-2-yl]anthracen-2-yl]-6-(trifluoromethyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 58028261 |
| Molecular Formula | C32H18F6N2S2 |
| Molecular Weight | 608.63 g/mol |
| Exact Mass | 608.08 |
| IUPAC Name | 2-[9,10-dimethyl-6-[6-(trifluoromethyl)-1,3-benzothiazol-2-yl]anthracen-2-yl]-6-(trifluoromethyl)-1,3-benzothiazole |
| SMILES | Cc1c2ccc(-c3nc4ccc(C(F)(F)F)cc4s3)cc2c(C)c2ccc(-c3nc4ccc(C(F)(F)F)cc4s3)cc12 |
| InChI | InChI=1S/C32H18F6N2S2/c1-15-21-7-3-18(30-40-26-10-6-20(32(36,37)38)14-28(26)42-30)12-24(21)16(2)22-8-4-17(11-23(15)22)29-39-25-9-5-19(31(33,34)35)13-27(25)41-29/h3-14H,1-2H3 |
| InChIKey | OWEMSRJCKXEOEB-UHFFFAOYSA-N |
| XLogP | 11.20 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.63 |
| LogP ≤ 5 | 11.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|