C16H13Cl6N3O3 — CID 58028385
[5-[2-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]ethenyl]-2,3-bis(hydroxymethyl)phenyl]methanol (PubChem CID 58028385) has the molecular formula C16H13Cl6N3O3 and a molecular weight of 508.02 g/mol. Its IUPAC name is [5-[2-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]ethenyl]-2,3-bis(hydroxymethyl)phenyl]methanol.
| Compound Name | [5-[2-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]ethenyl]-2,3-bis(hydroxymethyl)phenyl]methanol |
|---|---|
| PubChem CID | 58028385 |
| Molecular Formula | C16H13Cl6N3O3 |
| Molecular Weight | 508.02 g/mol |
| Exact Mass | 504.91 |
| IUPAC Name | [5-[2-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]ethenyl]-2,3-bis(hydroxymethyl)phenyl]methanol |
| SMILES | OCc1cc(C=Cc2nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n2)cc(CO)c1CO |
| InChI | InChI=1S/C16H13Cl6N3O3/c17-15(18,19)13-23-12(24-14(25-13)16(20,21)22)2-1-8-3-9(5-26)11(7-28)10(4-8)6-27/h1-4,26-28H,5-7H2 |
| InChIKey | QJCJXCWNNQLMLB-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.02 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|