About 5-propan-2-yl-2,3-dihydrothieno[3,4-b][1,4]dioxine
5-propan-2-yl-2,3-dihydrothieno[3,4-b][1,4]dioxine (PubChem CID 58029729) has the molecular formula C9H12O2S
and a molecular weight of 184.26 g/mol. Its IUPAC name is 5-propan-2-yl-2,3-dihydrothieno[3,4-b][1,4]dioxine.
Molecular Properties
| Compound Name | 5-propan-2-yl-2,3-dihydrothieno[3,4-b][1,4]dioxine |
| PubChem CID | 58029729 |
| Molecular Formula | C9H12O2S |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | 5-propan-2-yl-2,3-dihydrothieno[3,4-b][1,4]dioxine |
| SMILES | CC(C)c1scc2c1OCCO2 |
| InChI | InChI=1S/C9H12O2S/c1-6(2)9-8-7(5-12-9)10-3-4-11-8/h5-6H,3-4H2,1-2H3 |
| InChIKey | ATLVOVHCNQDPKZ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-propan-2-yl-2,3-dihydrothieno[3,4-b][1,4]dioxine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-propan-2-yl-2,3-dihydrothieno[3,4-b][1,4]dioxine?
The IUPAC name of 5-propan-2-yl-2,3-dihydrothieno[3,4-b][1,4]dioxine (CID 58029729) is 5-propan-2-yl-2,3-dihydrothieno[3,4-b][1,4]dioxine.
What is the SMILES notation for 5-propan-2-yl-2,3-dihydrothieno[3,4-b][1,4]dioxine?
The canonical SMILES for 5-propan-2-yl-2,3-dihydrothieno[3,4-b][1,4]dioxine is CC(C)c1scc2c1OCCO2.
What is the InChIKey of 5-propan-2-yl-2,3-dihydrothieno[3,4-b][1,4]dioxine?
The InChIKey is ATLVOVHCNQDPKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O2S/c1-6(2)9-8-7(5-12-9)10-3-4-11-8/h5-6H,3-4H2,1-2H3.
What are the key properties of 5-propan-2-yl-2,3-dihydrothieno[3,4-b][1,4]dioxine?
5-propan-2-yl-2,3-dihydrothieno[3,4-b][1,4]dioxine has a molecular weight of 184.26 g/mol, XLogP of 2.64, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-propan-2-yl-2,3-dihydrothieno[3,4-b][1,4]dioxine is sourced from PubChem (CID 58029729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).