About 1-methyl-3,5-di(propan-2-yl)pyrazolidine
1-methyl-3,5-di(propan-2-yl)pyrazolidine (PubChem CID 58029883) has the molecular formula C10H22N2
and a molecular weight of 170.30 g/mol. Its IUPAC name is 1-methyl-3,5-di(propan-2-yl)pyrazolidine.
Molecular Properties
| Compound Name | 1-methyl-3,5-di(propan-2-yl)pyrazolidine |
| PubChem CID | 58029883 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | 1-methyl-3,5-di(propan-2-yl)pyrazolidine |
| SMILES | CC(C)C1CC(C(C)C)N(C)N1 |
| InChI | InChI=1S/C10H22N2/c1-7(2)9-6-10(8(3)4)12(5)11-9/h7-11H,6H2,1-5H3 |
| InChIKey | JGKKNADDYMXLLB-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methyl-3,5-di(propan-2-yl)pyrazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3,5-di(propan-2-yl)pyrazolidine?
The IUPAC name of 1-methyl-3,5-di(propan-2-yl)pyrazolidine (CID 58029883) is 1-methyl-3,5-di(propan-2-yl)pyrazolidine.
What is the SMILES notation for 1-methyl-3,5-di(propan-2-yl)pyrazolidine?
The canonical SMILES for 1-methyl-3,5-di(propan-2-yl)pyrazolidine is CC(C)C1CC(C(C)C)N(C)N1.
What is the InChIKey of 1-methyl-3,5-di(propan-2-yl)pyrazolidine?
The InChIKey is JGKKNADDYMXLLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N2/c1-7(2)9-6-10(8(3)4)12(5)11-9/h7-11H,6H2,1-5H3.
What are the key properties of 1-methyl-3,5-di(propan-2-yl)pyrazolidine?
1-methyl-3,5-di(propan-2-yl)pyrazolidine has a molecular weight of 170.30 g/mol, XLogP of 1.88, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3,5-di(propan-2-yl)pyrazolidine is sourced from PubChem (CID 58029883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).