About 2-(1-adamantyl)-1,3-diphenylguanidine
2-(1-adamantyl)-1,3-diphenylguanidine (PubChem CID 58030681) has the molecular formula C23H27N3
and a molecular weight of 345.49 g/mol. Its IUPAC name is 2-(1-adamantyl)-1,3-diphenylguanidine.
Molecular Properties
| Compound Name | 2-(1-adamantyl)-1,3-diphenylguanidine |
| PubChem CID | 58030681 |
| Molecular Formula | C23H27N3 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | 2-(1-adamantyl)-1,3-diphenylguanidine |
| SMILES | c1ccc(NC(=NC23CC4CC(CC(C4)C2)C3)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C23H27N3/c1-3-7-20(8-4-1)24-22(25-21-9-5-2-6-10-21)26-23-14-17-11-18(15-23)13-19(12-17)16-23/h1-10,17-19H,11-16H2,(H2,24,25,26) |
| InChIKey | WUEBBSQADCGQFU-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-adamantyl)-1,3-diphenylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-adamantyl)-1,3-diphenylguanidine?
The IUPAC name of 2-(1-adamantyl)-1,3-diphenylguanidine (CID 58030681) is 2-(1-adamantyl)-1,3-diphenylguanidine.
What is the SMILES notation for 2-(1-adamantyl)-1,3-diphenylguanidine?
The canonical SMILES for 2-(1-adamantyl)-1,3-diphenylguanidine is c1ccc(NC(=NC23CC4CC(CC(C4)C2)C3)Nc2ccccc2)cc1.
What is the InChIKey of 2-(1-adamantyl)-1,3-diphenylguanidine?
The InChIKey is WUEBBSQADCGQFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27N3/c1-3-7-20(8-4-1)24-22(25-21-9-5-2-6-10-21)26-23-14-17-11-18(15-23)13-19(12-17)16-23/h1-10,17-19H,11-16H2,(H2,24,25,26).
What are the key properties of 2-(1-adamantyl)-1,3-diphenylguanidine?
2-(1-adamantyl)-1,3-diphenylguanidine has a molecular weight of 345.49 g/mol, XLogP of 5.54, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-adamantyl)-1,3-diphenylguanidine is sourced from PubChem (CID 58030681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).