C21H18F9NO6S2 — CID 58031032
1-O-(4-butan-2-ylphenyl) 3-O-[(Z)-(2,2,2-trifluoro-1-phenylethylidene)amino] 1,1,2,2,3,3-hexafluoropropane-1,3-disulfonate (PubChem CID 58031032) has the molecular formula C21H18F9NO6S2 and a molecular weight of 615.49 g/mol. Its IUPAC name is 1-O-(4-butan-2-ylphenyl) 3-O-[(Z)-(2,2,2-trifluoro-1-phenylethylidene)amino] 1,1,2,2,3,3-hexafluoropropane-1,3-disulfonate.
| Compound Name | 1-O-(4-butan-2-ylphenyl) 3-O-[(Z)-(2,2,2-trifluoro-1-phenylethylidene)amino] 1,1,2,2,3,3-hexafluoropropane-1,3-disulfonate |
|---|---|
| PubChem CID | 58031032 |
| Molecular Formula | C21H18F9NO6S2 |
| Molecular Weight | 615.49 g/mol |
| Exact Mass | 615.04 |
| IUPAC Name | 1-O-(4-butan-2-ylphenyl) 3-O-[(Z)-(2,2,2-trifluoro-1-phenylethylidene)amino] 1,1,2,2,3,3-hexafluoropropane-1,3-disulfonate |
| SMILES | CCC(C)c1ccc(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O/N=C(/c2ccccc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H18F9NO6S2/c1-3-13(2)14-9-11-16(12-10-14)36-38(32,33)20(27,28)19(25,26)21(29,30)39(34,35)37-31-17(18(22,23)24)15-7-5-4-6-8-15/h4-13H,3H2,1-2H3/b31-17- |
| InChIKey | DHOHPPQNUBZXKE-LJUMEUDFSA-N |
| XLogP | 6.04 |
| TPSA | 99.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.49 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|