C18H28O2 — CID 58031035
[1-(cyclohexylmethylperoxy)-2-methylbutyl]benzene (PubChem CID 58031035) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is [1-(cyclohexylmethylperoxy)-2-methylbutyl]benzene.
| Compound Name | [1-(cyclohexylmethylperoxy)-2-methylbutyl]benzene |
|---|---|
| PubChem CID | 58031035 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | [1-(cyclohexylmethylperoxy)-2-methylbutyl]benzene |
| SMILES | CCC(C)C(OOCC1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C18H28O2/c1-3-15(2)18(17-12-8-5-9-13-17)20-19-14-16-10-6-4-7-11-16/h5,8-9,12-13,15-16,18H,3-4,6-7,10-11,14H2,1-2H3 |
| InChIKey | TXLXTYIGVKDLJG-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|