C11H7F7O5S2 — CID 58031092
(4-ethenylphenyl) 1,1,2,2,3,3-hexafluoro-3-fluorosulfonylpropane-1-sulfonate (PubChem CID 58031092) has the molecular formula C11H7F7O5S2 and a molecular weight of 416.29 g/mol. Its IUPAC name is (4-ethenylphenyl) 1,1,2,2,3,3-hexafluoro-3-fluorosulfonylpropane-1-sulfonate.
| Compound Name | (4-ethenylphenyl) 1,1,2,2,3,3-hexafluoro-3-fluorosulfonylpropane-1-sulfonate |
|---|---|
| PubChem CID | 58031092 |
| Molecular Formula | C11H7F7O5S2 |
| Molecular Weight | 416.29 g/mol |
| Exact Mass | 415.96 |
| IUPAC Name | (4-ethenylphenyl) 1,1,2,2,3,3-hexafluoro-3-fluorosulfonylpropane-1-sulfonate |
| SMILES | C=Cc1ccc(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)F)cc1 |
| InChI | InChI=1S/C11H7F7O5S2/c1-2-7-3-5-8(6-4-7)23-25(21,22)11(16,17)9(12,13)10(14,15)24(18,19)20/h2-6H,1H2 |
| InChIKey | REAIFLNWUINJNO-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.29 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|