About 2,6-ditert-butyl-4-methoxy-3,5-dimethylphenol
2,6-ditert-butyl-4-methoxy-3,5-dimethylphenol (PubChem CID 58031358) has the molecular formula C17H28O2
and a molecular weight of 264.41 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-methoxy-3,5-dimethylphenol.
Molecular Properties
| Compound Name | 2,6-ditert-butyl-4-methoxy-3,5-dimethylphenol |
| PubChem CID | 58031358 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | 2,6-ditert-butyl-4-methoxy-3,5-dimethylphenol |
| SMILES | COc1c(C)c(C(C)(C)C)c(O)c(C(C)(C)C)c1C |
| InChI | InChI=1S/C17H28O2/c1-10-12(16(3,4)5)14(18)13(17(6,7)8)11(2)15(10)19-9/h18H,1-9H3 |
| InChIKey | CYAOTSKRHOKWCO-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,6-ditert-butyl-4-methoxy-3,5-dimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-ditert-butyl-4-methoxy-3,5-dimethylphenol?
The IUPAC name of 2,6-ditert-butyl-4-methoxy-3,5-dimethylphenol (CID 58031358) is 2,6-ditert-butyl-4-methoxy-3,5-dimethylphenol.
What is the SMILES notation for 2,6-ditert-butyl-4-methoxy-3,5-dimethylphenol?
The canonical SMILES for 2,6-ditert-butyl-4-methoxy-3,5-dimethylphenol is COc1c(C)c(C(C)(C)C)c(O)c(C(C)(C)C)c1C.
What is the InChIKey of 2,6-ditert-butyl-4-methoxy-3,5-dimethylphenol?
The InChIKey is CYAOTSKRHOKWCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28O2/c1-10-12(16(3,4)5)14(18)13(17(6,7)8)11(2)15(10)19-9/h18H,1-9H3.
What are the key properties of 2,6-ditert-butyl-4-methoxy-3,5-dimethylphenol?
2,6-ditert-butyl-4-methoxy-3,5-dimethylphenol has a molecular weight of 264.41 g/mol, XLogP of 4.61, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-ditert-butyl-4-methoxy-3,5-dimethylphenol is sourced from PubChem (CID 58031358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).