About 3-[4-[[1-[(3,5-dichloro-2-pyridinyl)oxymethyl]cyclopropyl]methoxy]phenyl]-3-methoxypropanoic acid
3-[4-[[1-[(3,5-dichloro-2-pyridinyl)oxymethyl]cyclopropyl]methoxy]phenyl]-3-methoxypropanoic acid (PubChem CID 58031854) has the molecular formula C20H21Cl2NO5
and a molecular weight of 426.30 g/mol. Its IUPAC name is 3-[4-[[1-[(3,5-dichloro-2-pyridinyl)oxymethyl]cyclopropyl]methoxy]phenyl]-3-methoxypropanoic acid.
Molecular Properties
| Compound Name | 3-[4-[[1-[(3,5-dichloro-2-pyridinyl)oxymethyl]cyclopropyl]methoxy]phenyl]-3-methoxypropanoic acid |
| PubChem CID | 58031854 |
| Molecular Formula | C20H21Cl2NO5 |
| Molecular Weight | 426.30 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | 3-[4-[[1-[(3,5-dichloro-2-pyridinyl)oxymethyl]cyclopropyl]methoxy]phenyl]-3-methoxypropanoic acid |
| SMILES | COC(CC(=O)O)c1ccc(OCC2(COc3ncc(Cl)cc3Cl)CC2)cc1 |
| InChI | InChI=1S/C20H21Cl2NO5/c1-26-17(9-18(24)25)13-2-4-15(5-3-13)27-11-20(6-7-20)12-28-19-16(22)8-14(21)10-23-19/h2-5,8,10,17H,6-7,9,11-12H2,1H3,(H,24,25) |
| InChIKey | RBFOCSOVPCQYRV-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.30 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[4-[[1-[(3,5-dichloro-2-pyridinyl)oxymethyl]cyclopropyl]methoxy]phenyl]-3-methoxypropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[[1-[(3,5-dichloro-2-pyridinyl)oxymethyl]cyclopropyl]methoxy]phenyl]-3-methoxypropanoic acid?
The IUPAC name of 3-[4-[[1-[(3,5-dichloro-2-pyridinyl)oxymethyl]cyclopropyl]methoxy]phenyl]-3-methoxypropanoic acid (CID 58031854) is 3-[4-[[1-[(3,5-dichloro-2-pyridinyl)oxymethyl]cyclopropyl]methoxy]phenyl]-3-methoxypropanoic acid.
What is the SMILES notation for 3-[4-[[1-[(3,5-dichloro-2-pyridinyl)oxymethyl]cyclopropyl]methoxy]phenyl]-3-methoxypropanoic acid?
The canonical SMILES for 3-[4-[[1-[(3,5-dichloro-2-pyridinyl)oxymethyl]cyclopropyl]methoxy]phenyl]-3-methoxypropanoic acid is COC(CC(=O)O)c1ccc(OCC2(COc3ncc(Cl)cc3Cl)CC2)cc1.
What is the InChIKey of 3-[4-[[1-[(3,5-dichloro-2-pyridinyl)oxymethyl]cyclopropyl]methoxy]phenyl]-3-methoxypropanoic acid?
The InChIKey is RBFOCSOVPCQYRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21Cl2NO5/c1-26-17(9-18(24)25)13-2-4-15(5-3-13)27-11-20(6-7-20)12-28-19-16(22)8-14(21)10-23-19/h2-5,8,10,17H,6-7,9,11-12H2,1H3,(H,24,25).
What are the key properties of 3-[4-[[1-[(3,5-dichloro-2-pyridinyl)oxymethyl]cyclopropyl]methoxy]phenyl]-3-methoxypropanoic acid?
3-[4-[[1-[(3,5-dichloro-2-pyridinyl)oxymethyl]cyclopropyl]methoxy]phenyl]-3-methoxypropanoic acid has a molecular weight of 426.30 g/mol, XLogP of 4.79, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[[1-[(3,5-dichloro-2-pyridinyl)oxymethyl]cyclopropyl]methoxy]phenyl]-3-methoxypropanoic acid is sourced from PubChem (CID 58031854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).