C30H23F2N5O4 — CID 58032231
[2-[3-fluoro-4-[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]phenyl]-1-[[5-(2-fluorophenyl)-2-pyridinyl]carbamoylamino]ethyl] formate (PubChem CID 58032231) has the molecular formula C30H23F2N5O4 and a molecular weight of 555.54 g/mol. Its IUPAC name is [2-[3-fluoro-4-[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]phenyl]-1-[[5-(2-fluorophenyl)-2-pyridinyl]carbamoylamino]ethyl] formate.
| Compound Name | [2-[3-fluoro-4-[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]phenyl]-1-[[5-(2-fluorophenyl)-2-pyridinyl]carbamoylamino]ethyl] formate |
|---|---|
| PubChem CID | 58032231 |
| Molecular Formula | C30H23F2N5O4 |
| Molecular Weight | 555.54 g/mol |
| Exact Mass | 555.17 |
| IUPAC Name | [2-[3-fluoro-4-[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]phenyl]-1-[[5-(2-fluorophenyl)-2-pyridinyl]carbamoylamino]ethyl] formate |
| SMILES | Cc1ccc(-c2nc(-c3ccc(CC(NC(=O)Nc4ccc(-c5ccccc5F)cn4)OC=O)cc3F)no2)cc1 |
| InChI | InChI=1S/C30H23F2N5O4/c1-18-6-9-20(10-7-18)29-36-28(37-41-29)23-12-8-19(14-25(23)32)15-27(40-17-38)35-30(39)34-26-13-11-21(16-33-26)22-4-2-3-5-24(22)31/h2-14,16-17,27H,15H2,1H3,(H2,33,34,35,39) |
| InChIKey | WMHSYNTXPVOCQX-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 119.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.54 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|