C28H21F2N5O4 — CID 58032256
[2-[3-fluoro-4-[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]phenyl]-1-[[3-(4-fluorophenyl)-1H-pyrazole-5-carbonyl]amino]ethyl] formate (PubChem CID 58032256) has the molecular formula C28H21F2N5O4 and a molecular weight of 529.50 g/mol. Its IUPAC name is [2-[3-fluoro-4-[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]phenyl]-1-[[3-(4-fluorophenyl)-1H-pyrazole-5-carbonyl]amino]ethyl] formate.
| Compound Name | [2-[3-fluoro-4-[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]phenyl]-1-[[3-(4-fluorophenyl)-1H-pyrazole-5-carbonyl]amino]ethyl] formate |
|---|---|
| PubChem CID | 58032256 |
| Molecular Formula | C28H21F2N5O4 |
| Molecular Weight | 529.50 g/mol |
| Exact Mass | 529.16 |
| IUPAC Name | [2-[3-fluoro-4-[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]phenyl]-1-[[3-(4-fluorophenyl)-1H-pyrazole-5-carbonyl]amino]ethyl] formate |
| SMILES | Cc1ccc(-c2nc(-c3ccc(CC(NC(=O)c4cc(-c5ccc(F)cc5)n[nH]4)OC=O)cc3F)no2)cc1 |
| InChI | InChI=1S/C28H21F2N5O4/c1-16-2-5-19(6-3-16)28-32-26(35-39-28)21-11-4-17(12-22(21)30)13-25(38-15-36)31-27(37)24-14-23(33-34-24)18-7-9-20(29)10-8-18/h2-12,14-15,25H,13H2,1H3,(H,31,37)(H,33,34) |
| InChIKey | SVPMKTLWGGPNSU-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 123.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.50 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|