C31H26FN5O4 — CID 58032278
[2-[3-fluoro-4-[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]phenyl]-1-[[5-(4-methylphenyl)-2-pyridinyl]carbamoylamino]ethyl] formate (PubChem CID 58032278) has the molecular formula C31H26FN5O4 and a molecular weight of 551.58 g/mol. Its IUPAC name is [2-[3-fluoro-4-[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]phenyl]-1-[[5-(4-methylphenyl)-2-pyridinyl]carbamoylamino]ethyl] formate.
| Compound Name | [2-[3-fluoro-4-[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]phenyl]-1-[[5-(4-methylphenyl)-2-pyridinyl]carbamoylamino]ethyl] formate |
|---|---|
| PubChem CID | 58032278 |
| Molecular Formula | C31H26FN5O4 |
| Molecular Weight | 551.58 g/mol |
| Exact Mass | 551.20 |
| IUPAC Name | [2-[3-fluoro-4-[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]phenyl]-1-[[5-(4-methylphenyl)-2-pyridinyl]carbamoylamino]ethyl] formate |
| SMILES | Cc1ccc(-c2ccc(NC(=O)NC(Cc3ccc(-c4noc(-c5ccc(C)cc5)n4)c(F)c3)OC=O)nc2)cc1 |
| InChI | InChI=1S/C31H26FN5O4/c1-19-3-8-22(9-4-19)24-12-14-27(33-17-24)34-31(39)35-28(40-18-38)16-21-7-13-25(26(32)15-21)29-36-30(41-37-29)23-10-5-20(2)6-11-23/h3-15,17-18,28H,16H2,1-2H3,(H2,33,34,35,39) |
| InChIKey | RSXWHVGKVLSZBY-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 119.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.58 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|