C28H23FN6O4 — CID 58032550
[2-[3-fluoro-4-[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]phenyl]-1-[(5-phenyl-1H-pyrazol-3-yl)carbamoylamino]ethyl] formate (PubChem CID 58032550) has the molecular formula C28H23FN6O4 and a molecular weight of 526.53 g/mol. Its IUPAC name is [2-[3-fluoro-4-[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]phenyl]-1-[(5-phenyl-1H-pyrazol-3-yl)carbamoylamino]ethyl] formate.
| Compound Name | [2-[3-fluoro-4-[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]phenyl]-1-[(5-phenyl-1H-pyrazol-3-yl)carbamoylamino]ethyl] formate |
|---|---|
| PubChem CID | 58032550 |
| Molecular Formula | C28H23FN6O4 |
| Molecular Weight | 526.53 g/mol |
| Exact Mass | 526.18 |
| IUPAC Name | [2-[3-fluoro-4-[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]phenyl]-1-[(5-phenyl-1H-pyrazol-3-yl)carbamoylamino]ethyl] formate |
| SMILES | Cc1ccc(-c2nc(-c3ccc(CC(NC(=O)Nc4cc(-c5ccccc5)[nH]n4)OC=O)cc3F)no2)cc1 |
| InChI | InChI=1S/C28H23FN6O4/c1-17-7-10-20(11-8-17)27-32-26(35-39-27)21-12-9-18(13-22(21)29)14-25(38-16-36)31-28(37)30-24-15-23(33-34-24)19-5-3-2-4-6-19/h2-13,15-16,25H,14H2,1H3,(H3,30,31,33,34,37) |
| InChIKey | XDUPXKLLFLNEEA-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 135.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.53 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|