C8H9NO3S2 — CID 58033060
2,3-dimethyl-1,1-dioxothieno[2,3-e]thiazin-4-ol (PubChem CID 58033060) has the molecular formula C8H9NO3S2 and a molecular weight of 231.30 g/mol. Its IUPAC name is 2,3-dimethyl-1,1-dioxothieno[2,3-e]thiazin-4-ol.
| Compound Name | 2,3-dimethyl-1,1-dioxothieno[2,3-e]thiazin-4-ol |
|---|---|
| PubChem CID | 58033060 |
| Molecular Formula | C8H9NO3S2 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.00 |
| IUPAC Name | 2,3-dimethyl-1,1-dioxothieno[2,3-e]thiazin-4-ol |
| SMILES | CC1=C(O)c2sccc2S(=O)(=O)N1C |
| InChI | InChI=1S/C8H9NO3S2/c1-5-7(10)8-6(3-4-13-8)14(11,12)9(5)2/h3-4,10H,1-2H3 |
| InChIKey | RHGOFXLMDHWXNC-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |