C14H12F6N2O — CID 58033202
(1R)-2,2,2-trifluoro-1-[(2R)-1-[4-isocyano-3-(trifluoromethyl)phenyl]pyrrolidin-2-yl]ethanol (PubChem CID 58033202) has the molecular formula C14H12F6N2O and a molecular weight of 338.25 g/mol. Its IUPAC name is (1R)-2,2,2-trifluoro-1-[(2R)-1-[4-isocyano-3-(trifluoromethyl)phenyl]pyrrolidin-2-yl]ethanol.
| Compound Name | (1R)-2,2,2-trifluoro-1-[(2R)-1-[4-isocyano-3-(trifluoromethyl)phenyl]pyrrolidin-2-yl]ethanol |
|---|---|
| PubChem CID | 58033202 |
| Molecular Formula | C14H12F6N2O |
| Molecular Weight | 338.25 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | (1R)-2,2,2-trifluoro-1-[(2R)-1-[4-isocyano-3-(trifluoromethyl)phenyl]pyrrolidin-2-yl]ethanol |
| SMILES | [C-]#[N+]c1ccc(N2CCC[C@@H]2[C@@H](O)C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C14H12F6N2O/c1-21-10-5-4-8(7-9(10)13(15,16)17)22-6-2-3-11(22)12(23)14(18,19)20/h4-5,7,11-12,23H,2-3,6H2/t11-,12-/m1/s1 |
| InChIKey | OMIFMGWADUOMFQ-VXGBXAGGSA-N |
| XLogP | 4.15 |
| TPSA | 27.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.25 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|