About N-tert-butyl-N-ethyl-2,2-dimethyloxane-4-carboxamide
N-tert-butyl-N-ethyl-2,2-dimethyloxane-4-carboxamide (PubChem CID 58033925) has the molecular formula C14H27NO2
and a molecular weight of 241.37 g/mol. Its IUPAC name is N-tert-butyl-N-ethyl-2,2-dimethyloxane-4-carboxamide.
Molecular Properties
| Compound Name | N-tert-butyl-N-ethyl-2,2-dimethyloxane-4-carboxamide |
| PubChem CID | 58033925 |
| Molecular Formula | C14H27NO2 |
| Molecular Weight | 241.37 g/mol |
| Exact Mass | 241.20 |
| IUPAC Name | N-tert-butyl-N-ethyl-2,2-dimethyloxane-4-carboxamide |
| SMILES | CCN(C(=O)C1CCOC(C)(C)C1)C(C)(C)C |
| InChI | InChI=1S/C14H27NO2/c1-7-15(13(2,3)4)12(16)11-8-9-17-14(5,6)10-11/h11H,7-10H2,1-6H3 |
| InChIKey | AGFSDCYSXUDWNM-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.37 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-tert-butyl-N-ethyl-2,2-dimethyloxane-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-N-ethyl-2,2-dimethyloxane-4-carboxamide?
The IUPAC name of N-tert-butyl-N-ethyl-2,2-dimethyloxane-4-carboxamide (CID 58033925) is N-tert-butyl-N-ethyl-2,2-dimethyloxane-4-carboxamide.
What is the SMILES notation for N-tert-butyl-N-ethyl-2,2-dimethyloxane-4-carboxamide?
The canonical SMILES for N-tert-butyl-N-ethyl-2,2-dimethyloxane-4-carboxamide is CCN(C(=O)C1CCOC(C)(C)C1)C(C)(C)C.
What is the InChIKey of N-tert-butyl-N-ethyl-2,2-dimethyloxane-4-carboxamide?
The InChIKey is AGFSDCYSXUDWNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27NO2/c1-7-15(13(2,3)4)12(16)11-8-9-17-14(5,6)10-11/h11H,7-10H2,1-6H3.
What are the key properties of N-tert-butyl-N-ethyl-2,2-dimethyloxane-4-carboxamide?
N-tert-butyl-N-ethyl-2,2-dimethyloxane-4-carboxamide has a molecular weight of 241.37 g/mol, XLogP of 2.84, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-N-ethyl-2,2-dimethyloxane-4-carboxamide is sourced from PubChem (CID 58033925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).