C24H23FN4O — CID 58034056
2-[1-(2-fluorophenyl)pyrazol-3-yl]-1-[4-[(5-isocyano-2-pyridinyl)methyl]cyclohexyl]ethanone (PubChem CID 58034056) has the molecular formula C24H23FN4O and a molecular weight of 402.47 g/mol. Its IUPAC name is 2-[1-(2-fluorophenyl)pyrazol-3-yl]-1-[4-[(5-isocyano-2-pyridinyl)methyl]cyclohexyl]ethanone.
| Compound Name | 2-[1-(2-fluorophenyl)pyrazol-3-yl]-1-[4-[(5-isocyano-2-pyridinyl)methyl]cyclohexyl]ethanone |
|---|---|
| PubChem CID | 58034056 |
| Molecular Formula | C24H23FN4O |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 2-[1-(2-fluorophenyl)pyrazol-3-yl]-1-[4-[(5-isocyano-2-pyridinyl)methyl]cyclohexyl]ethanone |
| SMILES | [C-]#[N+]c1ccc(CC2CCC(C(=O)Cc3ccn(-c4ccccc4F)n3)CC2)nc1 |
| InChI | InChI=1S/C24H23FN4O/c1-26-21-11-10-19(27-16-21)14-17-6-8-18(9-7-17)24(30)15-20-12-13-29(28-20)23-5-3-2-4-22(23)25/h2-5,10-13,16-18H,6-9,14-15H2 |
| InChIKey | MRNWWQFEGVYYAC-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 52.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|