C25H27N3O5 — CID 58034275
16,17-bis(hydroxymethyl)-21-[2-[methyl(propan-2-yl)amino]ethyl]-5,7-dioxa-11,21-diazapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(13),2,4(8),9,11,14(19),15,17-octaen-20-one (PubChem CID 58034275) has the molecular formula C25H27N3O5 and a molecular weight of 449.51 g/mol. Its IUPAC name is 16,17-bis(hydroxymethyl)-21-[2-[methyl(propan-2-yl)amino]ethyl]-5,7-dioxa-11,21-diazapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(13),2,4(8),9,11,14(19),15,17-octaen-20-one.
| Compound Name | 16,17-bis(hydroxymethyl)-21-[2-[methyl(propan-2-yl)amino]ethyl]-5,7-dioxa-11,21-diazapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(13),2,4(8),9,11,14(19),15,17-octaen-20-one |
|---|---|
| PubChem CID | 58034275 |
| Molecular Formula | C25H27N3O5 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | 16,17-bis(hydroxymethyl)-21-[2-[methyl(propan-2-yl)amino]ethyl]-5,7-dioxa-11,21-diazapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(13),2,4(8),9,11,14(19),15,17-octaen-20-one |
| SMILES | CC(C)N(C)CCn1c(=O)c2cc(CO)c(CO)cc2c2cnc3cc4c(cc3c21)OCO4 |
| InChI | InChI=1S/C25H27N3O5/c1-14(2)27(3)4-5-28-24-19-8-22-23(33-13-32-22)9-21(19)26-10-20(24)17-6-15(11-29)16(12-30)7-18(17)25(28)31/h6-10,14,29-30H,4-5,11-13H2,1-3H3 |
| InChIKey | ZVNOMCYJHAZULF-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 97.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|