C27H29N3O5 — CID 58034279
N-[2-(dimethylamino)-2-methylpropyl]-16,17-bis(hydroxymethyl)-5,7-dioxa-11-azapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(21),2,4(8),9,11,13,15,17,19-nonaene-20-carboxamide (PubChem CID 58034279) has the molecular formula C27H29N3O5 and a molecular weight of 475.55 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-methylpropyl]-16,17-bis(hydroxymethyl)-5,7-dioxa-11-azapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(21),2,4(8),9,11,13,15,17,19-nonaene-20-carboxamide.
| Compound Name | N-[2-(dimethylamino)-2-methylpropyl]-16,17-bis(hydroxymethyl)-5,7-dioxa-11-azapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(21),2,4(8),9,11,13,15,17,19-nonaene-20-carboxamide |
|---|---|
| PubChem CID | 58034279 |
| Molecular Formula | C27H29N3O5 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | N-[2-(dimethylamino)-2-methylpropyl]-16,17-bis(hydroxymethyl)-5,7-dioxa-11-azapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(21),2,4(8),9,11,13,15,17,19-nonaene-20-carboxamide |
| SMILES | CN(C)C(C)(C)CNC(=O)c1cc2c3cc4c(cc3ncc2c2cc(CO)c(CO)cc12)OCO4 |
| InChI | InChI=1S/C27H29N3O5/c1-27(2,30(3)4)13-29-26(33)21-7-19-20-8-24-25(35-14-34-24)9-23(20)28-10-22(19)18-6-16(12-32)15(11-31)5-17(18)21/h5-10,31-32H,11-14H2,1-4H3,(H,29,33) |
| InChIKey | JWEGNKHNCWOUNG-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 104.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|