C17H10ClN5 — CID 58034305
12-chloro-4-methyl-11-phenyl-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaene-5-carbonitrile (PubChem CID 58034305) has the molecular formula C17H10ClN5 and a molecular weight of 319.76 g/mol. Its IUPAC name is 12-chloro-4-methyl-11-phenyl-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaene-5-carbonitrile.
| Compound Name | 12-chloro-4-methyl-11-phenyl-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaene-5-carbonitrile |
|---|---|
| PubChem CID | 58034305 |
| Molecular Formula | C17H10ClN5 |
| Molecular Weight | 319.76 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 12-chloro-4-methyl-11-phenyl-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaene-5-carbonitrile |
| SMILES | Cc1nn2c(ncc3cc(-c4ccccc4)c(Cl)nc32)c1C#N |
| InChI | InChI=1S/C17H10ClN5/c1-10-14(8-19)17-20-9-12-7-13(11-5-3-2-4-6-11)15(18)21-16(12)23(17)22-10/h2-7,9H,1H3 |
| InChIKey | FMSPIWLFTSWTNW-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 66.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.76 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|