About (7-aminopyrazolo[1,5-a]pyrimidin-6-yl)methanol
(7-aminopyrazolo[1,5-a]pyrimidin-6-yl)methanol (PubChem CID 58034314) has the molecular formula C7H8N4O
and a molecular weight of 164.17 g/mol. Its IUPAC name is (7-aminopyrazolo[1,5-a]pyrimidin-6-yl)methanol.
Molecular Properties
| Compound Name | (7-aminopyrazolo[1,5-a]pyrimidin-6-yl)methanol |
| PubChem CID | 58034314 |
| Molecular Formula | C7H8N4O |
| Molecular Weight | 164.17 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | (7-aminopyrazolo[1,5-a]pyrimidin-6-yl)methanol |
| SMILES | Nc1c(CO)cnc2ccnn12 |
| InChI | InChI=1S/C7H8N4O/c8-7-5(4-12)3-9-6-1-2-10-11(6)7/h1-3,12H,4,8H2 |
| InChIKey | SMUDIRABSFALFX-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 76.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.17 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (7-aminopyrazolo[1,5-a]pyrimidin-6-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-aminopyrazolo[1,5-a]pyrimidin-6-yl)methanol?
The IUPAC name of (7-aminopyrazolo[1,5-a]pyrimidin-6-yl)methanol (CID 58034314) is (7-aminopyrazolo[1,5-a]pyrimidin-6-yl)methanol.
What is the SMILES notation for (7-aminopyrazolo[1,5-a]pyrimidin-6-yl)methanol?
The canonical SMILES for (7-aminopyrazolo[1,5-a]pyrimidin-6-yl)methanol is Nc1c(CO)cnc2ccnn12.
What is the InChIKey of (7-aminopyrazolo[1,5-a]pyrimidin-6-yl)methanol?
The InChIKey is SMUDIRABSFALFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4O/c8-7-5(4-12)3-9-6-1-2-10-11(6)7/h1-3,12H,4,8H2.
What are the key properties of (7-aminopyrazolo[1,5-a]pyrimidin-6-yl)methanol?
(7-aminopyrazolo[1,5-a]pyrimidin-6-yl)methanol has a molecular weight of 164.17 g/mol, XLogP of -0.20, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (7-aminopyrazolo[1,5-a]pyrimidin-6-yl)methanol is sourced from PubChem (CID 58034314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).