C27H30BNO5 — CID 58034403
2-[3-cyclopropyl-3-hydroxy-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclobutyl]isoindole-1,3-dione (PubChem CID 58034403) has the molecular formula C27H30BNO5 and a molecular weight of 459.35 g/mol. Its IUPAC name is 2-[3-cyclopropyl-3-hydroxy-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclobutyl]isoindole-1,3-dione.
| Compound Name | 2-[3-cyclopropyl-3-hydroxy-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclobutyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 58034403 |
| Molecular Formula | C27H30BNO5 |
| Molecular Weight | 459.35 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | 2-[3-cyclopropyl-3-hydroxy-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclobutyl]isoindole-1,3-dione |
| SMILES | CC1(C)OB(c2ccc(C3(N4C(=O)c5ccccc5C4=O)CC(O)(C4CC4)C3)cc2)OC1(C)C |
| InChI | InChI=1S/C27H30BNO5/c1-24(2)25(3,4)34-28(33-24)19-13-11-17(12-14-19)26(15-27(32,16-26)18-9-10-18)29-22(30)20-7-5-6-8-21(20)23(29)31/h5-8,11-14,18,32H,9-10,15-16H2,1-4H3 |
| InChIKey | XRVZJRLTVZNRLS-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.35 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|