C40H30N6O3 — CID 58034519
2-[3-hydroxy-3-methyl-1-[4-(4-methyl-11-phenyl-10-pyridin-4-yl-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl)phenyl]cyclobutyl]isoindole-1,3-dione (PubChem CID 58034519) has the molecular formula C40H30N6O3 and a molecular weight of 642.72 g/mol. Its IUPAC name is 2-[3-hydroxy-3-methyl-1-[4-(4-methyl-11-phenyl-10-pyridin-4-yl-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl)phenyl]cyclobutyl]isoindole-1,3-dione.
| Compound Name | 2-[3-hydroxy-3-methyl-1-[4-(4-methyl-11-phenyl-10-pyridin-4-yl-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl)phenyl]cyclobutyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 58034519 |
| Molecular Formula | C40H30N6O3 |
| Molecular Weight | 642.72 g/mol |
| Exact Mass | 642.24 |
| IUPAC Name | 2-[3-hydroxy-3-methyl-1-[4-(4-methyl-11-phenyl-10-pyridin-4-yl-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl)phenyl]cyclobutyl]isoindole-1,3-dione |
| SMILES | Cc1cc2ncc3c(-c4ccncc4)c(-c4ccccc4)c(-c4ccc(C5(N6C(=O)c7ccccc7C6=O)CC(C)(O)C5)cc4)nc3n2n1 |
| InChI | InChI=1S/C40H30N6O3/c1-24-20-32-42-21-31-33(26-16-18-41-19-17-26)34(25-8-4-3-5-9-25)35(43-36(31)46(32)44-24)27-12-14-28(15-13-27)40(22-39(2,49)23-40)45-37(47)29-10-6-7-11-30(29)38(45)48/h3-21,49H,22-23H2,1-2H3 |
| InChIKey | HFIIEJSWOASGLT-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 113.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.72 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|