C36H29N5O4 — CID 58034522
2-[3-hydroxy-1-[4-[11-(4-methoxyphenyl)-4-methyl-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl]phenyl]-3-methylcyclobutyl]isoindole-1,3-dione (PubChem CID 58034522) has the molecular formula C36H29N5O4 and a molecular weight of 595.66 g/mol. Its IUPAC name is 2-[3-hydroxy-1-[4-[11-(4-methoxyphenyl)-4-methyl-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl]phenyl]-3-methylcyclobutyl]isoindole-1,3-dione.
| Compound Name | 2-[3-hydroxy-1-[4-[11-(4-methoxyphenyl)-4-methyl-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl]phenyl]-3-methylcyclobutyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 58034522 |
| Molecular Formula | C36H29N5O4 |
| Molecular Weight | 595.66 g/mol |
| Exact Mass | 595.22 |
| IUPAC Name | 2-[3-hydroxy-1-[4-[11-(4-methoxyphenyl)-4-methyl-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl]phenyl]-3-methylcyclobutyl]isoindole-1,3-dione |
| SMILES | COc1ccc(-c2cc3cnc4cc(C)nn4c3nc2-c2ccc(C3(N4C(=O)c5ccccc5C4=O)CC(C)(O)C3)cc2)cc1 |
| InChI | InChI=1S/C36H29N5O4/c1-21-16-30-37-18-24-17-29(22-10-14-26(45-3)15-11-22)31(38-32(24)41(30)39-21)23-8-12-25(13-9-23)36(19-35(2,44)20-36)40-33(42)27-6-4-5-7-28(27)34(40)43/h4-18,44H,19-20H2,1-3H3 |
| InChIKey | FKYNWXUQTXDEEG-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 109.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.66 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|