C35H29N5O3S — CID 58034665
2-[3-hydroxy-3-methyl-1-[4-(4-propan-2-yl-11-thiophen-3-yl-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl)phenyl]cyclobutyl]isoindole-1,3-dione (PubChem CID 58034665) has the molecular formula C35H29N5O3S and a molecular weight of 599.72 g/mol. Its IUPAC name is 2-[3-hydroxy-3-methyl-1-[4-(4-propan-2-yl-11-thiophen-3-yl-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl)phenyl]cyclobutyl]isoindole-1,3-dione.
| Compound Name | 2-[3-hydroxy-3-methyl-1-[4-(4-propan-2-yl-11-thiophen-3-yl-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl)phenyl]cyclobutyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 58034665 |
| Molecular Formula | C35H29N5O3S |
| Molecular Weight | 599.72 g/mol |
| Exact Mass | 599.20 |
| IUPAC Name | 2-[3-hydroxy-3-methyl-1-[4-(4-propan-2-yl-11-thiophen-3-yl-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl)phenyl]cyclobutyl]isoindole-1,3-dione |
| SMILES | CC(C)c1cc2ncc3cc(-c4ccsc4)c(-c4ccc(C5(N6C(=O)c7ccccc7C6=O)CC(C)(O)C5)cc4)nc3n2n1 |
| InChI | InChI=1S/C35H29N5O3S/c1-20(2)28-15-29-36-16-23-14-27(22-12-13-44-17-22)30(37-31(23)40(29)38-28)21-8-10-24(11-9-21)35(18-34(3,43)19-35)39-32(41)25-6-4-5-7-26(25)33(39)42/h4-17,20,43H,18-19H2,1-3H3 |
| InChIKey | PVFGFXSUYLLGBV-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 100.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.72 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|