C15H9ClN4 — CID 58034666
12-chloro-11-phenyl-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaene (PubChem CID 58034666) has the molecular formula C15H9ClN4 and a molecular weight of 280.72 g/mol. Its IUPAC name is 12-chloro-11-phenyl-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaene.
| Compound Name | 12-chloro-11-phenyl-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaene |
|---|---|
| PubChem CID | 58034666 |
| Molecular Formula | C15H9ClN4 |
| Molecular Weight | 280.72 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 12-chloro-11-phenyl-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaene |
| SMILES | Clc1nc2c(cnc3ccnn32)cc1-c1ccccc1 |
| InChI | InChI=1S/C15H9ClN4/c16-14-12(10-4-2-1-3-5-10)8-11-9-17-13-6-7-18-20(13)15(11)19-14/h1-9H |
| InChIKey | BPXVAQMXMOFECT-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.72 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|