C16H13ClN4S — CID 58034697
12-chloro-4-propan-2-yl-11-thiophen-2-yl-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaene (PubChem CID 58034697) has the molecular formula C16H13ClN4S and a molecular weight of 328.83 g/mol. Its IUPAC name is 12-chloro-4-propan-2-yl-11-thiophen-2-yl-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaene.
| Compound Name | 12-chloro-4-propan-2-yl-11-thiophen-2-yl-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaene |
|---|---|
| PubChem CID | 58034697 |
| Molecular Formula | C16H13ClN4S |
| Molecular Weight | 328.83 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | 12-chloro-4-propan-2-yl-11-thiophen-2-yl-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaene |
| SMILES | CC(C)c1cc2ncc3cc(-c4cccs4)c(Cl)nc3n2n1 |
| InChI | InChI=1S/C16H13ClN4S/c1-9(2)12-7-14-18-8-10-6-11(13-4-3-5-22-13)15(17)19-16(10)21(14)20-12/h3-9H,1-2H3 |
| InChIKey | QEFYTQZFFMEFTO-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.83 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|