About 2-cyclopropylpyrazolo[1,5-a]pyrimidine-6,7-diamine
2-cyclopropylpyrazolo[1,5-a]pyrimidine-6,7-diamine (PubChem CID 58034777) has the molecular formula C9H11N5
and a molecular weight of 189.22 g/mol. Its IUPAC name is 2-cyclopropylpyrazolo[1,5-a]pyrimidine-6,7-diamine.
Molecular Properties
| Compound Name | 2-cyclopropylpyrazolo[1,5-a]pyrimidine-6,7-diamine |
| PubChem CID | 58034777 |
| Molecular Formula | C9H11N5 |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | 2-cyclopropylpyrazolo[1,5-a]pyrimidine-6,7-diamine |
| SMILES | Nc1cnc2cc(C3CC3)nn2c1N |
| InChI | InChI=1S/C9H11N5/c10-6-4-12-8-3-7(5-1-2-5)13-14(8)9(6)11/h3-5H,1-2,10-11H2 |
| InChIKey | HTRYYCLNNTUAFH-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 82.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-cyclopropylpyrazolo[1,5-a]pyrimidine-6,7-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropylpyrazolo[1,5-a]pyrimidine-6,7-diamine?
The IUPAC name of 2-cyclopropylpyrazolo[1,5-a]pyrimidine-6,7-diamine (CID 58034777) is 2-cyclopropylpyrazolo[1,5-a]pyrimidine-6,7-diamine.
What is the SMILES notation for 2-cyclopropylpyrazolo[1,5-a]pyrimidine-6,7-diamine?
The canonical SMILES for 2-cyclopropylpyrazolo[1,5-a]pyrimidine-6,7-diamine is Nc1cnc2cc(C3CC3)nn2c1N.
What is the InChIKey of 2-cyclopropylpyrazolo[1,5-a]pyrimidine-6,7-diamine?
The InChIKey is HTRYYCLNNTUAFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N5/c10-6-4-12-8-3-7(5-1-2-5)13-14(8)9(6)11/h3-5H,1-2,10-11H2.
What are the key properties of 2-cyclopropylpyrazolo[1,5-a]pyrimidine-6,7-diamine?
2-cyclopropylpyrazolo[1,5-a]pyrimidine-6,7-diamine has a molecular weight of 189.22 g/mol, XLogP of 0.77, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropylpyrazolo[1,5-a]pyrimidine-6,7-diamine is sourced from PubChem (CID 58034777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).