About 4-fluoro-N,N,4-trimethylcyclohexan-1-amine
4-fluoro-N,N,4-trimethylcyclohexan-1-amine (PubChem CID 58035218) has the molecular formula C9H18FN
and a molecular weight of 159.25 g/mol. Its IUPAC name is 4-fluoro-N,N,4-trimethylcyclohexan-1-amine.
Molecular Properties
| Compound Name | 4-fluoro-N,N,4-trimethylcyclohexan-1-amine |
| PubChem CID | 58035218 |
| Molecular Formula | C9H18FN |
| Molecular Weight | 159.25 g/mol |
| Exact Mass | 159.14 |
| IUPAC Name | 4-fluoro-N,N,4-trimethylcyclohexan-1-amine |
| SMILES | CN(C)C1CCC(C)(F)CC1 |
| InChI | InChI=1S/C9H18FN/c1-9(10)6-4-8(5-7-9)11(2)3/h8H,4-7H2,1-3H3 |
| InChIKey | HMOPLNCRHYQMSW-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.25 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-fluoro-N,N,4-trimethylcyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-N,N,4-trimethylcyclohexan-1-amine?
The IUPAC name of 4-fluoro-N,N,4-trimethylcyclohexan-1-amine (CID 58035218) is 4-fluoro-N,N,4-trimethylcyclohexan-1-amine.
What is the SMILES notation for 4-fluoro-N,N,4-trimethylcyclohexan-1-amine?
The canonical SMILES for 4-fluoro-N,N,4-trimethylcyclohexan-1-amine is CN(C)C1CCC(C)(F)CC1.
What is the InChIKey of 4-fluoro-N,N,4-trimethylcyclohexan-1-amine?
The InChIKey is HMOPLNCRHYQMSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18FN/c1-9(10)6-4-8(5-7-9)11(2)3/h8H,4-7H2,1-3H3.
What are the key properties of 4-fluoro-N,N,4-trimethylcyclohexan-1-amine?
4-fluoro-N,N,4-trimethylcyclohexan-1-amine has a molecular weight of 159.25 g/mol, XLogP of 2.22, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-N,N,4-trimethylcyclohexan-1-amine is sourced from PubChem (CID 58035218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).