C13H12F3NO — CID 58035274
(2S,6R)-6-[4-(trifluoromethyl)phenyl]oxane-2-carbonitrile (PubChem CID 58035274) has the molecular formula C13H12F3NO and a molecular weight of 255.24 g/mol. Its IUPAC name is (2S,6R)-6-[4-(trifluoromethyl)phenyl]oxane-2-carbonitrile.
| Compound Name | (2S,6R)-6-[4-(trifluoromethyl)phenyl]oxane-2-carbonitrile |
|---|---|
| PubChem CID | 58035274 |
| Molecular Formula | C13H12F3NO |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | (2S,6R)-6-[4-(trifluoromethyl)phenyl]oxane-2-carbonitrile |
| SMILES | N#C[C@@H]1CCC[C@H](c2ccc(C(F)(F)F)cc2)O1 |
| InChI | InChI=1S/C13H12F3NO/c14-13(15,16)10-6-4-9(5-7-10)12-3-1-2-11(8-17)18-12/h4-7,11-12H,1-3H2/t11-,12+/m0/s1 |
| InChIKey | VUPBRWBJAAATCR-NWDGAFQWSA-N |
| XLogP | 3.84 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |