About 3-fluoro-N,N-dimethyloxan-4-amine
3-fluoro-N,N-dimethyloxan-4-amine (PubChem CID 58035392) has the molecular formula C7H14FNO
and a molecular weight of 147.19 g/mol. Its IUPAC name is 3-fluoro-N,N-dimethyloxan-4-amine.
Molecular Properties
| Compound Name | 3-fluoro-N,N-dimethyloxan-4-amine |
| PubChem CID | 58035392 |
| Molecular Formula | C7H14FNO |
| Molecular Weight | 147.19 g/mol |
| Exact Mass | 147.11 |
| IUPAC Name | 3-fluoro-N,N-dimethyloxan-4-amine |
| SMILES | CN(C)C1CCOCC1F |
| InChI | InChI=1S/C7H14FNO/c1-9(2)7-3-4-10-5-6(7)8/h6-7H,3-5H2,1-2H3 |
| InChIKey | BDMQZHRMPUSNOE-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.19 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-fluoro-N,N-dimethyloxan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-N,N-dimethyloxan-4-amine?
The IUPAC name of 3-fluoro-N,N-dimethyloxan-4-amine (CID 58035392) is 3-fluoro-N,N-dimethyloxan-4-amine.
What is the SMILES notation for 3-fluoro-N,N-dimethyloxan-4-amine?
The canonical SMILES for 3-fluoro-N,N-dimethyloxan-4-amine is CN(C)C1CCOCC1F.
What is the InChIKey of 3-fluoro-N,N-dimethyloxan-4-amine?
The InChIKey is BDMQZHRMPUSNOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14FNO/c1-9(2)7-3-4-10-5-6(7)8/h6-7H,3-5H2,1-2H3.
What are the key properties of 3-fluoro-N,N-dimethyloxan-4-amine?
3-fluoro-N,N-dimethyloxan-4-amine has a molecular weight of 147.19 g/mol, XLogP of 0.68, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-N,N-dimethyloxan-4-amine is sourced from PubChem (CID 58035392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).