C22H27NO4 — CID 58035824
(3R,6R)-2,3,5-trihydroxy-6,7-dimethyl-N-(2-phenylpropyl)-3,4,5,6-tetrahydronaphthalene-1-carboxamide (PubChem CID 58035824) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is (3R,6R)-2,3,5-trihydroxy-6,7-dimethyl-N-(2-phenylpropyl)-3,4,5,6-tetrahydronaphthalene-1-carboxamide.
| Compound Name | (3R,6R)-2,3,5-trihydroxy-6,7-dimethyl-N-(2-phenylpropyl)-3,4,5,6-tetrahydronaphthalene-1-carboxamide |
|---|---|
| PubChem CID | 58035824 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | (3R,6R)-2,3,5-trihydroxy-6,7-dimethyl-N-(2-phenylpropyl)-3,4,5,6-tetrahydronaphthalene-1-carboxamide |
| SMILES | CC1=CC2=C(C[C@@H](O)C(O)=C2C(=O)NCC(C)c2ccccc2)C(O)[C@@H]1C |
| InChI | InChI=1S/C22H27NO4/c1-12-9-16-17(20(25)14(12)3)10-18(24)21(26)19(16)22(27)23-11-13(2)15-7-5-4-6-8-15/h4-9,13-14,18,20,24-26H,10-11H2,1-3H3,(H,23,27)/t13?,14-,18-,20?/m1/s1 |
| InChIKey | QDDGMFCTVQKKST-YMWCWGQWSA-N |
| XLogP | 2.74 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |