C19H20N2O3S2 — CID 58036089
3-[4-[5-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]pyridin-1-ium-1-yl]propane-1-sulfonate (PubChem CID 58036089) has the molecular formula C19H20N2O3S2 and a molecular weight of 388.51 g/mol. Its IUPAC name is 3-[4-[5-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]pyridin-1-ium-1-yl]propane-1-sulfonate.
| Compound Name | 3-[4-[5-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]pyridin-1-ium-1-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 58036089 |
| Molecular Formula | C19H20N2O3S2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | 3-[4-[5-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]pyridin-1-ium-1-yl]propane-1-sulfonate |
| SMILES | Cc1ccc(-c2cnc(-c3cc[n+](CCCS(=O)(=O)[O-])cc3)s2)cc1C |
| InChI | InChI=1S/C19H20N2O3S2/c1-14-4-5-17(12-15(14)2)18-13-20-19(25-18)16-6-9-21(10-7-16)8-3-11-26(22,23)24/h4-7,9-10,12-13H,3,8,11H2,1-2H3 |
| InChIKey | KNBKGGXWQHLIBB-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 73.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|