About CID 58036640
CID 58036640 (PubChem CID 58036640) has the molecular formula C17H14BIrN4
and a molecular weight of 477.36 g/mol.
Molecular Properties
| Compound Name | CID 58036640 |
| PubChem CID | 58036640 |
| Molecular Formula | C17H14BIrN4 |
| Molecular Weight | 477.36 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | — |
| SMILES | CN1[B]N(c2ccc(-c3ccccn3)cn2)c2ccccc21.[Ir] |
| InChI | InChI=1S/C17H14BN4.Ir/c1-21-15-7-2-3-8-16(15)22(18-21)17-10-9-13(12-20-17)14-6-4-5-11-19-14;/h2-12H,1H3; |
| InChIKey | KXKUZIZNAJNSRT-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 477.36 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 58036640 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58036640?
The IUPAC name of CID 58036640 (CID 58036640) is not available.
What is the SMILES notation for CID 58036640?
The canonical SMILES for CID 58036640 is CN1[B]N(c2ccc(-c3ccccn3)cn2)c2ccccc21.[Ir].
What is the InChIKey of CID 58036640?
The InChIKey is KXKUZIZNAJNSRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14BN4.Ir/c1-21-15-7-2-3-8-16(15)22(18-21)17-10-9-13(12-20-17)14-6-4-5-11-19-14;/h2-12H,1H3;.
What are the key properties of CID 58036640?
CID 58036640 has a molecular weight of 477.36 g/mol, XLogP of 3.26, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58036640 is sourced from PubChem (CID 58036640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).