About CID 58036666
CID 58036666 (PubChem CID 58036666) has the molecular formula C10H10BN6
and a molecular weight of 225.04 g/mol.
Molecular Properties
| Compound Name | CID 58036666 |
| PubChem CID | 58036666 |
| Molecular Formula | C10H10BN6 |
| Molecular Weight | 225.04 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | — |
| SMILES | [B]1N(c2cnccn2)CCN1c1cnccn1 |
| InChI | InChI=1S/C10H10BN6/c1-3-14-9(7-12-1)16-5-6-17(11-16)10-8-13-2-4-15-10/h1-4,7-8H,5-6H2 |
| InChIKey | INXWKRFHGJPVBC-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 58.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.04 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 58036666 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58036666?
The IUPAC name of CID 58036666 (CID 58036666) is not available.
What is the SMILES notation for CID 58036666?
The canonical SMILES for CID 58036666 is [B]1N(c2cnccn2)CCN1c1cnccn1.
What is the InChIKey of CID 58036666?
The InChIKey is INXWKRFHGJPVBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10BN6/c1-3-14-9(7-12-1)16-5-6-17(11-16)10-8-13-2-4-15-10/h1-4,7-8H,5-6H2.
What are the key properties of CID 58036666?
CID 58036666 has a molecular weight of 225.04 g/mol, XLogP of 0.13, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58036666 is sourced from PubChem (CID 58036666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).