C26H32F2N2O4 — CID 58036814
5-[(1R)-2-[6-(2,2-difluoro-2-phenylethoxy)hexylamino]-1-hydroxyethyl]-8-methoxy-1H-quinolin-2-one (PubChem CID 58036814) has the molecular formula C26H32F2N2O4 and a molecular weight of 474.55 g/mol. Its IUPAC name is 5-[(1R)-2-[6-(2,2-difluoro-2-phenylethoxy)hexylamino]-1-hydroxyethyl]-8-methoxy-1H-quinolin-2-one.
| Compound Name | 5-[(1R)-2-[6-(2,2-difluoro-2-phenylethoxy)hexylamino]-1-hydroxyethyl]-8-methoxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 58036814 |
| Molecular Formula | C26H32F2N2O4 |
| Molecular Weight | 474.55 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | 5-[(1R)-2-[6-(2,2-difluoro-2-phenylethoxy)hexylamino]-1-hydroxyethyl]-8-methoxy-1H-quinolin-2-one |
| SMILES | COc1ccc([C@@H](O)CNCCCCCCOCC(F)(F)c2ccccc2)c2ccc(=O)[nH]c12 |
| InChI | InChI=1S/C26H32F2N2O4/c1-33-23-13-11-20(21-12-14-24(32)30-25(21)23)22(31)17-29-15-7-2-3-8-16-34-18-26(27,28)19-9-5-4-6-10-19/h4-6,9-14,22,29,31H,2-3,7-8,15-18H2,1H3,(H,30,32)/t22-/m0/s1 |
| InChIKey | BQUDDVYAVMJOGC-QFIPXVFZSA-N |
| XLogP | 4.53 |
| TPSA | 83.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.55 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|