C6H9F4O4S- — CID 58036988
1,1,2,2-tetrafluoro-6-hydroxyhexane-1-sulfonate (PubChem CID 58036988) has the molecular formula C6H9F4O4S- and a molecular weight of 253.19 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-6-hydroxyhexane-1-sulfonate.
| Compound Name | 1,1,2,2-tetrafluoro-6-hydroxyhexane-1-sulfonate |
|---|---|
| PubChem CID | 58036988 |
| Molecular Formula | C6H9F4O4S- |
| Molecular Weight | 253.19 g/mol |
| Exact Mass | 253.02 |
| IUPAC Name | 1,1,2,2-tetrafluoro-6-hydroxyhexane-1-sulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)(F)CCCCO |
| InChI | InChI=1S/C6H10F4O4S/c7-5(8,3-1-2-4-11)6(9,10)15(12,13)14/h11H,1-4H2,(H,12,13,14)/p-1 |
| InChIKey | RRKUROUSNZOQSN-UHFFFAOYSA-M |
| XLogP | 0.92 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.19 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|