C8H6F2N2S — CID 58037133
5,6-difluoro-4,7-dimethyl-2,1,3-benzothiadiazole (PubChem CID 58037133) has the molecular formula C8H6F2N2S and a molecular weight of 200.21 g/mol. Its IUPAC name is 5,6-difluoro-4,7-dimethyl-2,1,3-benzothiadiazole.
| Compound Name | 5,6-difluoro-4,7-dimethyl-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 58037133 |
| Molecular Formula | C8H6F2N2S |
| Molecular Weight | 200.21 g/mol |
| Exact Mass | 200.02 |
| IUPAC Name | 5,6-difluoro-4,7-dimethyl-2,1,3-benzothiadiazole |
| SMILES | Cc1c(F)c(F)c(C)c2nsnc12 |
| InChI | InChI=1S/C8H6F2N2S/c1-3-5(9)6(10)4(2)8-7(3)11-13-12-8/h1-2H3 |
| InChIKey | DHEMFSOIOTXKSZ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.21 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |