C30H26F8N4S2 — CID 58037242
2-hexyl-5-[1,2,4,5,6,7,9,10-octafluoro-8-(5-hexyl-1,3,4-thiadiazol-2-yl)phenanthren-3-yl]-1,3,4-thiadiazole (PubChem CID 58037242) has the molecular formula C30H26F8N4S2 and a molecular weight of 658.68 g/mol. Its IUPAC name is 2-hexyl-5-[1,2,4,5,6,7,9,10-octafluoro-8-(5-hexyl-1,3,4-thiadiazol-2-yl)phenanthren-3-yl]-1,3,4-thiadiazole.
| Compound Name | 2-hexyl-5-[1,2,4,5,6,7,9,10-octafluoro-8-(5-hexyl-1,3,4-thiadiazol-2-yl)phenanthren-3-yl]-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 58037242 |
| Molecular Formula | C30H26F8N4S2 |
| Molecular Weight | 658.68 g/mol |
| Exact Mass | 658.15 |
| IUPAC Name | 2-hexyl-5-[1,2,4,5,6,7,9,10-octafluoro-8-(5-hexyl-1,3,4-thiadiazol-2-yl)phenanthren-3-yl]-1,3,4-thiadiazole |
| SMILES | CCCCCCc1nnc(-c2c(F)c(F)c3c(F)c(F)c4c(-c5nnc(CCCCCC)s5)c(F)c(F)c(F)c4c3c2F)s1 |
| InChI | InChI=1S/C30H26F8N4S2/c1-3-5-7-9-11-13-39-41-29(43-13)19-17-15(23(33)28(38)26(19)36)16-18(24(34)22(17)32)25(35)27(37)20(21(16)31)30-42-40-14(44-30)12-10-8-6-4-2/h3-12H2,1-2H3 |
| InChIKey | JBYRVRVLWFEXAG-UHFFFAOYSA-N |
| XLogP | 10.39 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.68 |
| LogP ≤ 5 | 10.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|