C26H18F8N4S2 — CID 58037244
2-butyl-5-[6-(5-butyl-1,3,4-thiadiazol-2-yl)-1,3,4,5,7,8,9,10-octafluorophenanthren-2-yl]-1,3,4-thiadiazole (PubChem CID 58037244) has the molecular formula C26H18F8N4S2 and a molecular weight of 602.58 g/mol. Its IUPAC name is 2-butyl-5-[6-(5-butyl-1,3,4-thiadiazol-2-yl)-1,3,4,5,7,8,9,10-octafluorophenanthren-2-yl]-1,3,4-thiadiazole.
| Compound Name | 2-butyl-5-[6-(5-butyl-1,3,4-thiadiazol-2-yl)-1,3,4,5,7,8,9,10-octafluorophenanthren-2-yl]-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 58037244 |
| Molecular Formula | C26H18F8N4S2 |
| Molecular Weight | 602.58 g/mol |
| Exact Mass | 602.08 |
| IUPAC Name | 2-butyl-5-[6-(5-butyl-1,3,4-thiadiazol-2-yl)-1,3,4,5,7,8,9,10-octafluorophenanthren-2-yl]-1,3,4-thiadiazole |
| SMILES | CCCCc1nnc(-c2c(F)c(F)c3c(c2F)c(F)c(F)c2c(F)c(F)c(-c4nnc(CCCC)s4)c(F)c23)s1 |
| InChI | InChI=1S/C26H18F8N4S2/c1-3-5-7-9-35-37-25(39-9)15-17(27)11-12-13(20(30)21(31)14(11)22(32)24(15)34)18(28)16(23(33)19(12)29)26-38-36-10(40-26)8-6-4-2/h3-8H2,1-2H3 |
| InChIKey | PNFRETKCVNCZER-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.58 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|