C22H10F8N4S2 — CID 58037248
2-ethyl-5-[6-(5-ethyl-1,3,4-thiadiazol-2-yl)-1,3,4,5,7,8,9,10-octafluoroanthracen-2-yl]-1,3,4-thiadiazole (PubChem CID 58037248) has the molecular formula C22H10F8N4S2 and a molecular weight of 546.47 g/mol. Its IUPAC name is 2-ethyl-5-[6-(5-ethyl-1,3,4-thiadiazol-2-yl)-1,3,4,5,7,8,9,10-octafluoroanthracen-2-yl]-1,3,4-thiadiazole.
| Compound Name | 2-ethyl-5-[6-(5-ethyl-1,3,4-thiadiazol-2-yl)-1,3,4,5,7,8,9,10-octafluoroanthracen-2-yl]-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 58037248 |
| Molecular Formula | C22H10F8N4S2 |
| Molecular Weight | 546.47 g/mol |
| Exact Mass | 546.02 |
| IUPAC Name | 2-ethyl-5-[6-(5-ethyl-1,3,4-thiadiazol-2-yl)-1,3,4,5,7,8,9,10-octafluoroanthracen-2-yl]-1,3,4-thiadiazole |
| SMILES | CCc1nnc(-c2c(F)c(F)c3c(F)c4c(F)c(-c5nnc(CC)s5)c(F)c(F)c4c(F)c3c2F)s1 |
| InChI | InChI=1S/C22H10F8N4S2/c1-3-5-31-33-21(35-5)11-15(25)7-9(17(27)19(11)29)14(24)8-10(13(7)23)18(28)20(30)12(16(8)26)22-34-32-6(4-2)36-22/h3-4H2,1-2H3 |
| InChIKey | NMOSZAIJFQMGAI-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.47 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|