C31H27BN4O2 — CID 58037657
2,3-dipyridin-2-yl-10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-f]phenanthridine (PubChem CID 58037657) has the molecular formula C31H27BN4O2 and a molecular weight of 498.40 g/mol. Its IUPAC name is 2,3-dipyridin-2-yl-10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-f]phenanthridine.
| Compound Name | 2,3-dipyridin-2-yl-10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-f]phenanthridine |
|---|---|
| PubChem CID | 58037657 |
| Molecular Formula | C31H27BN4O2 |
| Molecular Weight | 498.40 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | 2,3-dipyridin-2-yl-10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-f]phenanthridine |
| SMILES | CC1(C)OB(c2ccc3c(c2)c2ccccc2n2c(-c4ccccn4)c(-c4ccccn4)nc32)OC1(C)C |
| InChI | InChI=1S/C31H27BN4O2/c1-30(2)31(3,4)38-32(37-30)20-15-16-22-23(19-20)21-11-5-6-14-26(21)36-28(25-13-8-10-18-34-25)27(35-29(22)36)24-12-7-9-17-33-24/h5-19H,1-4H3 |
| InChIKey | CRLIBSBVFJKSCY-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 61.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.40 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|