C23H21BN4O2 — CID 58038104
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9,12,14,21-tetrazapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2(7),3,5,8,10,12,15,17,19-decaene (PubChem CID 58038104) has the molecular formula C23H21BN4O2 and a molecular weight of 396.26 g/mol. Its IUPAC name is 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9,12,14,21-tetrazapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2(7),3,5,8,10,12,15,17,19-decaene.
| Compound Name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9,12,14,21-tetrazapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2(7),3,5,8,10,12,15,17,19-decaene |
|---|---|
| PubChem CID | 58038104 |
| Molecular Formula | C23H21BN4O2 |
| Molecular Weight | 396.26 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9,12,14,21-tetrazapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2(7),3,5,8,10,12,15,17,19-decaene |
| SMILES | CC1(C)OB(c2ccc3c(c2)c2nccnc2n2c4ccccc4nc32)OC1(C)C |
| InChI | InChI=1S/C23H21BN4O2/c1-22(2)23(3,4)30-24(29-22)14-9-10-15-16(13-14)19-21(26-12-11-25-19)28-18-8-6-5-7-17(18)27-20(15)28/h5-13H,1-4H3 |
| InChIKey | WGEZMCAJNOJSSM-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 61.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.26 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|